C14H12N2S — CID 145005659
1-(4-methylphenyl)sulfanylpyrrolo[3,2-b]pyridine (PubChem CID 145005659) has the molecular formula C14H12N2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfanylpyrrolo[3,2-b]pyridine.
| Compound Name | 1-(4-methylphenyl)sulfanylpyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 145005659 |
| Molecular Formula | C14H12N2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 1-(4-methylphenyl)sulfanylpyrrolo[3,2-b]pyridine |
| SMILES | Cc1ccc(Sn2ccc3ncccc32)cc1 |
| InChI | InChI=1S/C14H12N2S/c1-11-4-6-12(7-5-11)17-16-10-8-13-14(16)3-2-9-15-13/h2-10H,1H3 |
| InChIKey | VFRVRKCSXSCBEW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |