C39H40 — CID 145007218
2,9-dimethyl-9-(3-methylcyclohepta-3,5-dien-1-yl)-3-(2,9,9-trimethyl-7,8-dihydrofluoren-3-yl)fluorene (PubChem CID 145007218) has the molecular formula C39H40 and a molecular weight of 508.75 g/mol. Its IUPAC name is 2,9-dimethyl-9-(3-methylcyclohepta-3,5-dien-1-yl)-3-(2,9,9-trimethyl-7,8-dihydrofluoren-3-yl)fluorene.
| Compound Name | 2,9-dimethyl-9-(3-methylcyclohepta-3,5-dien-1-yl)-3-(2,9,9-trimethyl-7,8-dihydrofluoren-3-yl)fluorene |
|---|---|
| PubChem CID | 145007218 |
| Molecular Formula | C39H40 |
| Molecular Weight | 508.75 g/mol |
| Exact Mass | 508.31 |
| IUPAC Name | 2,9-dimethyl-9-(3-methylcyclohepta-3,5-dien-1-yl)-3-(2,9,9-trimethyl-7,8-dihydrofluoren-3-yl)fluorene |
| SMILES | CC1=CC=CCC(C2(C)c3ccccc3-c3cc(-c4cc5c(cc4C)C(C)(C)C4=C5C=CCC4)c(C)cc32)C1 |
| InChI | InChI=1S/C39H40/c1-24-13-7-8-14-27(19-24)39(6)35-18-12-10-16-29(35)33-23-31(26(3)21-37(33)39)30-22-32-28-15-9-11-17-34(28)38(4,5)36(32)20-25(30)2/h7-10,12-13,15-16,18,20-23,27H,11,14,17,19H2,1-6H3 |
| InChIKey | POXYOGRXNOMPNH-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.75 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |