C27H25F3N4O3 — CID 145008137
4-[(E)-2-acetyl-1-[hydroxy(methyl)amino]-3-[3-(trifluoromethyl)anilino]but-2-enyl]-3-(1-methyl-6-oxo-3-pyridinyl)benzonitrile (PubChem CID 145008137) has the molecular formula C27H25F3N4O3 and a molecular weight of 510.52 g/mol. Its IUPAC name is 4-[(E)-2-acetyl-1-[hydroxy(methyl)amino]-3-[3-(trifluoromethyl)anilino]but-2-enyl]-3-(1-methyl-6-oxo-3-pyridinyl)benzonitrile.
| Compound Name | 4-[(E)-2-acetyl-1-[hydroxy(methyl)amino]-3-[3-(trifluoromethyl)anilino]but-2-enyl]-3-(1-methyl-6-oxo-3-pyridinyl)benzonitrile |
|---|---|
| PubChem CID | 145008137 |
| Molecular Formula | C27H25F3N4O3 |
| Molecular Weight | 510.52 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 4-[(E)-2-acetyl-1-[hydroxy(methyl)amino]-3-[3-(trifluoromethyl)anilino]but-2-enyl]-3-(1-methyl-6-oxo-3-pyridinyl)benzonitrile |
| SMILES | CC(=O)/C(=C(\C)Nc1cccc(C(F)(F)F)c1)C(c1ccc(C#N)cc1-c1ccc(=O)n(C)c1)N(C)O |
| InChI | InChI=1S/C27H25F3N4O3/c1-16(32-21-7-5-6-20(13-21)27(28,29)30)25(17(2)35)26(34(4)37)22-10-8-18(14-31)12-23(22)19-9-11-24(36)33(3)15-19/h5-13,15,26,32,37H,1-4H3/b25-16- |
| InChIKey | ZLNIUWMSGSXFET-XYGWBWBKSA-N |
| XLogP | 5.28 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|