C26H26F3N3O6 — CID 69351639
2-acetyl-3-(4-cyanophenyl)-4-[2-methoxyethyl(methyl)carbamoyl]-5-oxo-5-[3-(trifluoromethyl)anilino]pentanoic acid (PubChem CID 69351639) has the molecular formula C26H26F3N3O6 and a molecular weight of 533.50 g/mol. Its IUPAC name is 2-acetyl-3-(4-cyanophenyl)-4-[2-methoxyethyl(methyl)carbamoyl]-5-oxo-5-[3-(trifluoromethyl)anilino]pentanoic acid.
| Compound Name | 2-acetyl-3-(4-cyanophenyl)-4-[2-methoxyethyl(methyl)carbamoyl]-5-oxo-5-[3-(trifluoromethyl)anilino]pentanoic acid |
|---|---|
| PubChem CID | 69351639 |
| Molecular Formula | C26H26F3N3O6 |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 2-acetyl-3-(4-cyanophenyl)-4-[2-methoxyethyl(methyl)carbamoyl]-5-oxo-5-[3-(trifluoromethyl)anilino]pentanoic acid |
| SMILES | COCCN(C)C(=O)C(C(=O)Nc1cccc(C(F)(F)F)c1)C(c1ccc(C#N)cc1)C(C(C)=O)C(=O)O |
| InChI | InChI=1S/C26H26F3N3O6/c1-15(33)20(25(36)37)21(17-9-7-16(14-30)8-10-17)22(24(35)32(2)11-12-38-3)23(34)31-19-6-4-5-18(13-19)26(27,28)29/h4-10,13,20-22H,11-12H2,1-3H3,(H,31,34)(H,36,37) |
| InChIKey | SUMPXWHUHWXVQQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 136.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|