C18H17N7O — CID 145011106
4-[4-amino-7-(1-cyanopyrrolidin-3-yl)pyrrolo[3,2-d]pyrimidin-5-yl]benzamide (PubChem CID 145011106) has the molecular formula C18H17N7O and a molecular weight of 347.38 g/mol. Its IUPAC name is 4-[4-amino-7-(1-cyanopyrrolidin-3-yl)pyrrolo[3,2-d]pyrimidin-5-yl]benzamide.
| Compound Name | 4-[4-amino-7-(1-cyanopyrrolidin-3-yl)pyrrolo[3,2-d]pyrimidin-5-yl]benzamide |
|---|---|
| PubChem CID | 145011106 |
| Molecular Formula | C18H17N7O |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 4-[4-amino-7-(1-cyanopyrrolidin-3-yl)pyrrolo[3,2-d]pyrimidin-5-yl]benzamide |
| SMILES | N#CN1CCC(c2cn(-c3ccc(C(N)=O)cc3)c3c(N)ncnc23)C1 |
| InChI | InChI=1S/C18H17N7O/c19-9-24-6-5-12(7-24)14-8-25(16-15(14)22-10-23-17(16)20)13-3-1-11(2-4-13)18(21)26/h1-4,8,10,12H,5-7H2,(H2,21,26)(H2,20,22,23) |
| InChIKey | QDYCCMDEJUAKOW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|