C19H13N7O2 — CID 145011122
4-[6-amino-9-(3-cyanophenyl)-8-oxopurin-7-yl]benzamide (PubChem CID 145011122) has the molecular formula C19H13N7O2 and a molecular weight of 371.36 g/mol. Its IUPAC name is 4-[6-amino-9-(3-cyanophenyl)-8-oxopurin-7-yl]benzamide.
| Compound Name | 4-[6-amino-9-(3-cyanophenyl)-8-oxopurin-7-yl]benzamide |
|---|---|
| PubChem CID | 145011122 |
| Molecular Formula | C19H13N7O2 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 4-[6-amino-9-(3-cyanophenyl)-8-oxopurin-7-yl]benzamide |
| SMILES | N#Cc1cccc(-n2c(=O)n(-c3ccc(C(N)=O)cc3)c3c(N)ncnc32)c1 |
| InChI | InChI=1S/C19H13N7O2/c20-9-11-2-1-3-14(8-11)26-18-15(16(21)23-10-24-18)25(19(26)28)13-6-4-12(5-7-13)17(22)27/h1-8,10H,(H2,22,27)(H2,21,23,24) |
| InChIKey | ILHQUFVQYZHFJJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |