C11H11F3NO+ — CID 145011968
(3S)-3-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-1,4-oxazin-1-ium (PubChem CID 145011968) has the molecular formula C11H11F3NO+ and a molecular weight of 230.21 g/mol. Its IUPAC name is (3S)-3-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-1,4-oxazin-1-ium.
| Compound Name | (3S)-3-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-1,4-oxazin-1-ium |
|---|---|
| PubChem CID | 145011968 |
| Molecular Formula | C11H11F3NO+ |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | (3S)-3-[4-(trifluoromethyl)phenyl]-3,6-dihydro-2H-1,4-oxazin-1-ium |
| SMILES | FC(F)(F)c1ccc([C@H]2C[OH+]CC=N2)cc1 |
| InChI | InChI=1S/C11H10F3NO/c12-11(13,14)9-3-1-8(2-4-9)10-7-16-6-5-15-10/h1-5,10H,6-7H2/p+1/t10-/m1/s1 |
| InChIKey | MQLFOFJGUAMIQP-SNVBAGLBSA-O |
| XLogP | 2.36 |
| TPSA | 25.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|