C16H18F3NO2 — CID 24795138
(3R,6R)-5-pent-4-enyl-3-phenyl-6-(trifluoromethyl)-2,3-dihydro-1,4-oxazin-6-ol (PubChem CID 24795138) has the molecular formula C16H18F3NO2 and a molecular weight of 313.32 g/mol. Its IUPAC name is (3R,6R)-5-pent-4-enyl-3-phenyl-6-(trifluoromethyl)-2,3-dihydro-1,4-oxazin-6-ol.
| Compound Name | (3R,6R)-5-pent-4-enyl-3-phenyl-6-(trifluoromethyl)-2,3-dihydro-1,4-oxazin-6-ol |
|---|---|
| PubChem CID | 24795138 |
| Molecular Formula | C16H18F3NO2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (3R,6R)-5-pent-4-enyl-3-phenyl-6-(trifluoromethyl)-2,3-dihydro-1,4-oxazin-6-ol |
| SMILES | C=CCCCC1=N[C@H](c2ccccc2)CO[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C16H18F3NO2/c1-2-3-5-10-14-15(21,16(17,18)19)22-11-13(20-14)12-8-6-4-7-9-12/h2,4,6-9,13,21H,1,3,5,10-11H2/t13-,15+/m0/s1 |
| InChIKey | UOMXPFSKKSAKNK-DZGCQCFKSA-N |
| XLogP | 3.81 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|