C13H19F2N — CID 145011973
2-[(2E,4Z)-7,7-difluoro-6-methylideneocta-2,4-dien-3-yl]pyrrolidine (PubChem CID 145011973) has the molecular formula C13H19F2N and a molecular weight of 227.30 g/mol. Its IUPAC name is 2-[(2E,4Z)-7,7-difluoro-6-methylideneocta-2,4-dien-3-yl]pyrrolidine.
| Compound Name | 2-[(2E,4Z)-7,7-difluoro-6-methylideneocta-2,4-dien-3-yl]pyrrolidine |
|---|---|
| PubChem CID | 145011973 |
| Molecular Formula | C13H19F2N |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2-[(2E,4Z)-7,7-difluoro-6-methylideneocta-2,4-dien-3-yl]pyrrolidine |
| SMILES | C=C(/C=C\C(=C/C)C1CCCN1)C(C)(F)F |
| InChI | InChI=1S/C13H19F2N/c1-4-11(12-6-5-9-16-12)8-7-10(2)13(3,14)15/h4,7-8,12,16H,2,5-6,9H2,1,3H3/b8-7-,11-4+ |
| InChIKey | HBUKTSQHQSMDRU-WJMWGRLLSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|