About methyl 3-amino-2-chloropyridine-4-carboxylate;4-propan-2-ylmorpholine
methyl 3-amino-2-chloropyridine-4-carboxylate;4-propan-2-ylmorpholine (PubChem CID 145012145) has the molecular formula C14H22ClN3O3
and a molecular weight of 315.80 g/mol. Its IUPAC name is methyl 3-amino-2-chloropyridine-4-carboxylate;4-propan-2-ylmorpholine.
Molecular Properties
| Compound Name | methyl 3-amino-2-chloropyridine-4-carboxylate;4-propan-2-ylmorpholine |
| PubChem CID | 145012145 |
| Molecular Formula | C14H22ClN3O3 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | methyl 3-amino-2-chloropyridine-4-carboxylate;4-propan-2-ylmorpholine |
| SMILES | CC(C)N1CCOCC1.COC(=O)c1ccnc(Cl)c1N |
| InChI | InChI=1S/C7H7ClN2O2.C7H15NO/c1-12-7(11)4-2-3-10-6(8)5(4)9;1-7(2)8-3-5-9-6-4-8/h2-3H,9H2,1H3;7H,3-6H2,1-2H3 |
| InChIKey | XYQOZTHBFYYHEA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-amino-2-chloropyridine-4-carboxylate;4-propan-2-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-amino-2-chloropyridine-4-carboxylate;4-propan-2-ylmorpholine?
The IUPAC name of methyl 3-amino-2-chloropyridine-4-carboxylate;4-propan-2-ylmorpholine (CID 145012145) is methyl 3-amino-2-chloropyridine-4-carboxylate;4-propan-2-ylmorpholine.
What is the SMILES notation for methyl 3-amino-2-chloropyridine-4-carboxylate;4-propan-2-ylmorpholine?
The canonical SMILES for methyl 3-amino-2-chloropyridine-4-carboxylate;4-propan-2-ylmorpholine is CC(C)N1CCOCC1.COC(=O)c1ccnc(Cl)c1N.
What is the InChIKey of methyl 3-amino-2-chloropyridine-4-carboxylate;4-propan-2-ylmorpholine?
The InChIKey is XYQOZTHBFYYHEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClN2O2.C7H15NO/c1-12-7(11)4-2-3-10-6(8)5(4)9;1-7(2)8-3-5-9-6-4-8/h2-3H,9H2,1H3;7H,3-6H2,1-2H3.
What are the key properties of methyl 3-amino-2-chloropyridine-4-carboxylate;4-propan-2-ylmorpholine?
methyl 3-amino-2-chloropyridine-4-carboxylate;4-propan-2-ylmorpholine has a molecular weight of 315.80 g/mol, XLogP of 1.83, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-2-chloropyridine-4-carboxylate;4-propan-2-ylmorpholine is sourced from PubChem (CID 145012145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).