C28H38N6O5S — CID 145025893
N-[6-[3-(6-aminohexoxy)-5-propoxyphenoxy]-1,3-dimethyl-2-oxobenzimidazol-5-yl]-1-methylimidazole-4-sulfinamide (PubChem CID 145025893) has the molecular formula C28H38N6O5S and a molecular weight of 570.72 g/mol. Its IUPAC name is N-[6-[3-(6-aminohexoxy)-5-propoxyphenoxy]-1,3-dimethyl-2-oxobenzimidazol-5-yl]-1-methylimidazole-4-sulfinamide.
| Compound Name | N-[6-[3-(6-aminohexoxy)-5-propoxyphenoxy]-1,3-dimethyl-2-oxobenzimidazol-5-yl]-1-methylimidazole-4-sulfinamide |
|---|---|
| PubChem CID | 145025893 |
| Molecular Formula | C28H38N6O5S |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | N-[6-[3-(6-aminohexoxy)-5-propoxyphenoxy]-1,3-dimethyl-2-oxobenzimidazol-5-yl]-1-methylimidazole-4-sulfinamide |
| SMILES | CCCOc1cc(OCCCCCCN)cc(Oc2cc3c(cc2NS(=O)c2cn(C)cn2)n(C)c(=O)n3C)c1 |
| InChI | InChI=1S/C28H38N6O5S/c1-5-11-37-20-13-21(38-12-9-7-6-8-10-29)15-22(14-20)39-26-17-25-24(33(3)28(35)34(25)4)16-23(26)31-40(36)27-18-32(2)19-30-27/h13-19,31H,5-12,29H2,1-4H3 |
| InChIKey | PIBPYYMZETXSGN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 127.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|