C16H20 — CID 145030351
[(1R,2R)-2-hexa-1,2-dien-3-yl-1-methylcyclopropyl]benzene (PubChem CID 145030351) has the molecular formula C16H20 and a molecular weight of 212.34 g/mol. Its IUPAC name is [(1R,2R)-2-hexa-1,2-dien-3-yl-1-methylcyclopropyl]benzene.
| Compound Name | [(1R,2R)-2-hexa-1,2-dien-3-yl-1-methylcyclopropyl]benzene |
|---|---|
| PubChem CID | 145030351 |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | [(1R,2R)-2-hexa-1,2-dien-3-yl-1-methylcyclopropyl]benzene |
| SMILES | C=C=C(CCC)[C@H]1C[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C16H20/c1-4-9-13(5-2)15-12-16(15,3)14-10-7-6-8-11-14/h6-8,10-11,15H,2,4,9,12H2,1,3H3/t15-,16+/m1/s1 |
| InChIKey | FICLPZONVABDIN-CVEARBPZSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |