C18H19NO3 — CID 136588702
cis-(1R,2S)-N-[(2,6-dihydroxyphenyl)methyl]-2-methyl-2-phenylcyclopropane-1-carboxamide (PubChem CID 136588702) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is cis-(1R,2S)-N-[(2,6-dihydroxyphenyl)methyl]-2-methyl-2-phenylcyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-[(2,6-dihydroxyphenyl)methyl]-2-methyl-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 136588702 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | cis-(1R,2S)-N-[(2,6-dihydroxyphenyl)methyl]-2-methyl-2-phenylcyclopropane-1-carboxamide |
| SMILES | C[C@]1(c2ccccc2)C[C@H]1C(=O)NCc1c(O)cccc1O |
| InChI | InChI=1S/C18H19NO3/c1-18(12-6-3-2-4-7-12)10-14(18)17(22)19-11-13-15(20)8-5-9-16(13)21/h2-9,14,20-21H,10-11H2,1H3,(H,19,22)/t14-,18+/m0/s1 |
| InChIKey | CGVZIOBBNFKNJR-KBXCAEBGSA-N |
| XLogP | 2.69 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|