C15H15N2O4- — CID 11906244
(Z)-4-[2-[(1R,2S)-2-methyl-2-phenylcyclopropanecarbonyl]hydrazinyl]-4-oxobut-2-enoate (PubChem CID 11906244) has the molecular formula C15H15N2O4- and a molecular weight of 287.30 g/mol. Its IUPAC name is (Z)-4-[2-[(1R,2S)-2-methyl-2-phenylcyclopropanecarbonyl]hydrazinyl]-4-oxobut-2-enoate.
| Compound Name | (Z)-4-[2-[(1R,2S)-2-methyl-2-phenylcyclopropanecarbonyl]hydrazinyl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 11906244 |
| Molecular Formula | C15H15N2O4- |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | (Z)-4-[2-[(1R,2S)-2-methyl-2-phenylcyclopropanecarbonyl]hydrazinyl]-4-oxobut-2-enoate |
| SMILES | C[C@]1(c2ccccc2)C[C@H]1C(=O)NNC(=O)/C=C\C(=O)[O-] |
| InChI | InChI=1S/C15H16N2O4/c1-15(10-5-3-2-4-6-10)9-11(15)14(21)17-16-12(18)7-8-13(19)20/h2-8,11H,9H2,1H3,(H,16,18)(H,17,21)(H,19,20)/p-1/b8-7-/t11-,15+/m0/s1 |
| InChIKey | XNOVRFRGUGRHII-AANTUONFSA-M |
| XLogP | -0.58 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|