C36H38N2O5 — CID 145031928
[2-[7-[N-(2-ethylhexyl)-2-methylanilino]-2-oxochromen-3-yl]-1,3-benzoxazol-6-yl]methyl 2-methylprop-2-enoate (PubChem CID 145031928) has the molecular formula C36H38N2O5 and a molecular weight of 578.71 g/mol. Its IUPAC name is [2-[7-[N-(2-ethylhexyl)-2-methylanilino]-2-oxochromen-3-yl]-1,3-benzoxazol-6-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [2-[7-[N-(2-ethylhexyl)-2-methylanilino]-2-oxochromen-3-yl]-1,3-benzoxazol-6-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145031928 |
| Molecular Formula | C36H38N2O5 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.28 |
| IUPAC Name | [2-[7-[N-(2-ethylhexyl)-2-methylanilino]-2-oxochromen-3-yl]-1,3-benzoxazol-6-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1ccc2nc(-c3cc4ccc(N(CC(CC)CCCC)c5ccccc5C)cc4oc3=O)oc2c1 |
| InChI | InChI=1S/C36H38N2O5/c1-6-8-12-25(7-2)21-38(31-13-10-9-11-24(31)5)28-16-15-27-19-29(36(40)43-32(27)20-28)34-37-30-17-14-26(18-33(30)42-34)22-41-35(39)23(3)4/h9-11,13-20,25H,3,6-8,12,21-22H2,1-2,4-5H3 |
| InChIKey | OWTQOQSESXDELV-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 85.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|