C11H14N4 — CID 145033572
methane;2-pyridin-2-ylpyridine-3,4-diamine (PubChem CID 145033572) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is methane;2-pyridin-2-ylpyridine-3,4-diamine.
| Compound Name | methane;2-pyridin-2-ylpyridine-3,4-diamine |
|---|---|
| PubChem CID | 145033572 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | methane;2-pyridin-2-ylpyridine-3,4-diamine |
| SMILES | C.Nc1ccnc(-c2ccccn2)c1N |
| InChI | InChI=1S/C10H10N4.CH4/c11-7-4-6-14-10(9(7)12)8-3-1-2-5-13-8;/h1-6H,12H2,(H2,11,14);1H4 |
| InChIKey | FOULBJQSEKOWGQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |