C20H21ClN4O5S — CID 145039684
5-chloro-N-[4-(2-hydroxypropan-2-ylcarbamoylsulfamoyl)phenyl]-1-methylindole-2-carboxamide (PubChem CID 145039684) has the molecular formula C20H21ClN4O5S and a molecular weight of 464.93 g/mol. Its IUPAC name is 5-chloro-N-[4-(2-hydroxypropan-2-ylcarbamoylsulfamoyl)phenyl]-1-methylindole-2-carboxamide.
| Compound Name | 5-chloro-N-[4-(2-hydroxypropan-2-ylcarbamoylsulfamoyl)phenyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 145039684 |
| Molecular Formula | C20H21ClN4O5S |
| Molecular Weight | 464.93 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | 5-chloro-N-[4-(2-hydroxypropan-2-ylcarbamoylsulfamoyl)phenyl]-1-methylindole-2-carboxamide |
| SMILES | Cn1c(C(=O)Nc2ccc(S(=O)(=O)NC(=O)NC(C)(C)O)cc2)cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H21ClN4O5S/c1-20(2,28)23-19(27)24-31(29,30)15-7-5-14(6-8-15)22-18(26)17-11-12-10-13(21)4-9-16(12)25(17)3/h4-11,28H,1-3H3,(H,22,26)(H2,23,24,27) |
| InChIKey | GXAQIHMMYNDBRR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 129.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.93 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|