C31H37NO3S — CID 145042515
3-ethoxy-10-(4-methylphenyl)sulfanyloxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline;2-ethoxyprop-1-ene (PubChem CID 145042515) has the molecular formula C31H37NO3S and a molecular weight of 503.71 g/mol. Its IUPAC name is 3-ethoxy-10-(4-methylphenyl)sulfanyloxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline;2-ethoxyprop-1-ene.
| Compound Name | 3-ethoxy-10-(4-methylphenyl)sulfanyloxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline;2-ethoxyprop-1-ene |
|---|---|
| PubChem CID | 145042515 |
| Molecular Formula | C31H37NO3S |
| Molecular Weight | 503.71 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | 3-ethoxy-10-(4-methylphenyl)sulfanyloxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline;2-ethoxyprop-1-ene |
| SMILES | C=C(C)OCC.CCOc1ccc2c(c1)CCN1Cc3cc(OSc4ccc(C)cc4)ccc3CC21 |
| InChI | InChI=1S/C26H27NO2S.C5H10O/c1-3-28-22-8-11-25-20(14-22)12-13-27-17-21-15-23(7-6-19(21)16-26(25)27)29-30-24-9-4-18(2)5-10-24;1-4-6-5(2)3/h4-11,14-15,26H,3,12-13,16-17H2,1-2H3;2,4H2,1,3H3 |
| InChIKey | QVDRAXMPNCMJBK-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.71 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|