C43H57NO7S — CID 145042650
[9-(benzenesulfinyloxy)-13-hydroxy-3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-yl] (E)-octadec-9-enoate (PubChem CID 145042650) has the molecular formula C43H57NO7S and a molecular weight of 732.00 g/mol. Its IUPAC name is [9-(benzenesulfinyloxy)-13-hydroxy-3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-yl] (E)-octadec-9-enoate.
| Compound Name | [9-(benzenesulfinyloxy)-13-hydroxy-3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-yl] (E)-octadec-9-enoate |
|---|---|
| PubChem CID | 145042650 |
| Molecular Formula | C43H57NO7S |
| Molecular Weight | 732.00 g/mol |
| Exact Mass | 731.39 |
| IUPAC Name | [9-(benzenesulfinyloxy)-13-hydroxy-3,10-dimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-2-yl] (E)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)Oc1cc2c(cc1OC)CCN1Cc3c(ccc(OC)c3OS(=O)c3ccccc3)C(O)C21 |
| InChI | InChI=1S/C43H57NO7S/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-24-40(45)50-39-30-35-32(29-38(39)49-3)27-28-44-31-36-34(42(46)41(35)44)25-26-37(48-2)43(36)51-52(47)33-22-19-18-20-23-33/h11-12,18-20,22-23,25-26,29-30,41-42,46H,4-10,13-17,21,24,27-28,31H2,1-3H3/b12-11+ |
| InChIKey | NIRBMGNNHBGWBT-VAWYXSNFSA-N |
| XLogP | 9.89 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.00 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|