C25H29FN4O — CID 145043892
(9R)-3-fluoro-7-oxa-18,21,25,29-tetrazahexacyclo[20.5.2.12,6.09,18.012,16.025,28]triaconta-1(28),2,4,6(30),22(29),23,26-heptaene (PubChem CID 145043892) has the molecular formula C25H29FN4O and a molecular weight of 420.53 g/mol. Its IUPAC name is (9R)-3-fluoro-7-oxa-18,21,25,29-tetrazahexacyclo[20.5.2.12,6.09,18.012,16.025,28]triaconta-1(28),2,4,6(30),22(29),23,26-heptaene.
| Compound Name | (9R)-3-fluoro-7-oxa-18,21,25,29-tetrazahexacyclo[20.5.2.12,6.09,18.012,16.025,28]triaconta-1(28),2,4,6(30),22(29),23,26-heptaene |
|---|---|
| PubChem CID | 145043892 |
| Molecular Formula | C25H29FN4O |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | (9R)-3-fluoro-7-oxa-18,21,25,29-tetrazahexacyclo[20.5.2.12,6.09,18.012,16.025,28]triaconta-1(28),2,4,6(30),22(29),23,26-heptaene |
| SMILES | Fc1ccc2cc1-c1ccn3ccc(nc13)NCCN1CC3CCCC3CC[C@@H]1CO2 |
| InChI | InChI=1S/C25H29FN4O/c26-23-7-6-20-14-22(23)21-8-11-29-12-9-24(28-25(21)29)27-10-13-30-15-18-3-1-2-17(18)4-5-19(30)16-31-20/h6-9,11-12,14,17-19H,1-5,10,13,15-16H2,(H,27,28)/t17?,18?,19-/m1/s1 |
| InChIKey | BSTCWWRUDFSWJE-CTWPCTMYSA-N |
| XLogP | 4.83 |
| TPSA | 41.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |