C22H26FN5O — CID 145044003
11-ethyl-3-fluoro-7-oxa-11,14,17,21,25-pentazapentacyclo[16.5.2.12,6.09,14.021,24]hexacosa-1(24),2,4,6(26),18(25),19,22-heptaene (PubChem CID 145044003) has the molecular formula C22H26FN5O and a molecular weight of 395.48 g/mol. Its IUPAC name is 11-ethyl-3-fluoro-7-oxa-11,14,17,21,25-pentazapentacyclo[16.5.2.12,6.09,14.021,24]hexacosa-1(24),2,4,6(26),18(25),19,22-heptaene.
| Compound Name | 11-ethyl-3-fluoro-7-oxa-11,14,17,21,25-pentazapentacyclo[16.5.2.12,6.09,14.021,24]hexacosa-1(24),2,4,6(26),18(25),19,22-heptaene |
|---|---|
| PubChem CID | 145044003 |
| Molecular Formula | C22H26FN5O |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 11-ethyl-3-fluoro-7-oxa-11,14,17,21,25-pentazapentacyclo[16.5.2.12,6.09,14.021,24]hexacosa-1(24),2,4,6(26),18(25),19,22-heptaene |
| SMILES | CCN1CCN2CCNc3ccn4ccc(c4n3)-c3cc(ccc3F)OCC2C1 |
| InChI | InChI=1S/C22H26FN5O/c1-2-26-11-12-27-10-7-24-21-6-9-28-8-5-18(22(28)25-21)19-13-17(3-4-20(19)23)29-15-16(27)14-26/h3-6,8-9,13,16H,2,7,10-12,14-15H2,1H3,(H,24,25) |
| InChIKey | PTOGSOPNLXNCBL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 45.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |