C21H23FN4O — CID 163559153
(8S)-3-fluoro-7-oxa-10,16,20,24-tetrazapentacyclo[15.5.2.12,6.18,13.020,23]hexacosa-1(23),2,4,6(26),17(24),18,21-heptaene (PubChem CID 163559153) has the molecular formula C21H23FN4O and a molecular weight of 366.44 g/mol. Its IUPAC name is (8S)-3-fluoro-7-oxa-10,16,20,24-tetrazapentacyclo[15.5.2.12,6.18,13.020,23]hexacosa-1(23),2,4,6(26),17(24),18,21-heptaene.
| Compound Name | (8S)-3-fluoro-7-oxa-10,16,20,24-tetrazapentacyclo[15.5.2.12,6.18,13.020,23]hexacosa-1(23),2,4,6(26),17(24),18,21-heptaene |
|---|---|
| PubChem CID | 163559153 |
| Molecular Formula | C21H23FN4O |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (8S)-3-fluoro-7-oxa-10,16,20,24-tetrazapentacyclo[15.5.2.12,6.18,13.020,23]hexacosa-1(23),2,4,6(26),17(24),18,21-heptaene |
| SMILES | Fc1ccc2cc1-c1ccn3ccc(nc13)NCCC1CCNC[C@H](C1)O2 |
| InChI | InChI=1S/C21H23FN4O/c22-19-2-1-15-12-18(19)17-5-9-26-10-6-20(25-21(17)26)24-8-4-14-3-7-23-13-16(11-14)27-15/h1-2,5-6,9-10,12,14,16,23H,3-4,7-8,11,13H2,(H,24,25)/t14?,16-/m0/s1 |
| InChIKey | FPRURFOWKHLGES-WMCAAGNKSA-N |
| XLogP | 3.70 |
| TPSA | 50.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |