C63H60N2 — CID 145044757
6-N-(3-methylphenyl)-1-N,6-N-bis(2-methyl-4-phenylphenyl)-1-N-[(3E,5Z)-octa-3,5,7-trien-4-yl]-3,8-di(propan-2-yl)pyrene-1,6-diamine (PubChem CID 145044757) has the molecular formula C63H60N2 and a molecular weight of 845.19 g/mol. Its IUPAC name is 6-N-(3-methylphenyl)-1-N,6-N-bis(2-methyl-4-phenylphenyl)-1-N-[(3E,5Z)-octa-3,5,7-trien-4-yl]-3,8-di(propan-2-yl)pyrene-1,6-diamine.
| Compound Name | 6-N-(3-methylphenyl)-1-N,6-N-bis(2-methyl-4-phenylphenyl)-1-N-[(3E,5Z)-octa-3,5,7-trien-4-yl]-3,8-di(propan-2-yl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 145044757 |
| Molecular Formula | C63H60N2 |
| Molecular Weight | 845.19 g/mol |
| Exact Mass | 844.48 |
| IUPAC Name | 6-N-(3-methylphenyl)-1-N,6-N-bis(2-methyl-4-phenylphenyl)-1-N-[(3E,5Z)-octa-3,5,7-trien-4-yl]-3,8-di(propan-2-yl)pyrene-1,6-diamine |
| SMILES | C=C/C=C\C(=C/CC)N(c1ccc(-c2ccccc2)cc1C)c1cc(C(C)C)c2ccc3c(N(c4cccc(C)c4)c4ccc(-c5ccccc5)cc4C)cc(C(C)C)c4ccc1c2c43 |
| InChI | InChI=1S/C63H60N2/c1-10-12-26-50(20-11-2)64(58-34-28-48(37-44(58)8)46-22-15-13-16-23-46)60-39-56(41(3)4)52-31-33-55-61(40-57(42(5)6)53-30-32-54(60)62(52)63(53)55)65(51-27-19-21-43(7)36-51)59-35-29-49(38-45(59)9)47-24-17-14-18-25-47/h10,12-42H,1,11H2,2-9H3/b26-12-,50-20+ |
| InChIKey | VEEVKZAHDKIUHO-OJPXEKSOSA-N |
| XLogP | 18.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.19 |
| LogP ≤ 5 | 18.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|