C30H48N6O7 — CID 145050800
6-(2,5-dioxopyrrol-1-yl)-N-[3-methyl-1-[[5-(methylamino)-1-oxopentan-2-yl]amino]-1-oxobutan-2-yl]hexanamide;formamide;[4-(methylamino)phenyl]methanol (PubChem CID 145050800) has the molecular formula C30H48N6O7 and a molecular weight of 604.75 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N-[3-methyl-1-[[5-(methylamino)-1-oxopentan-2-yl]amino]-1-oxobutan-2-yl]hexanamide;formamide;[4-(methylamino)phenyl]methanol.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N-[3-methyl-1-[[5-(methylamino)-1-oxopentan-2-yl]amino]-1-oxobutan-2-yl]hexanamide;formamide;[4-(methylamino)phenyl]methanol |
|---|---|
| PubChem CID | 145050800 |
| Molecular Formula | C30H48N6O7 |
| Molecular Weight | 604.75 g/mol |
| Exact Mass | 604.36 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N-[3-methyl-1-[[5-(methylamino)-1-oxopentan-2-yl]amino]-1-oxobutan-2-yl]hexanamide;formamide;[4-(methylamino)phenyl]methanol |
| SMILES | CNCCCC(C=O)NC(=O)C(NC(=O)CCCCCN1C(=O)C=CC1=O)C(C)C.CNc1ccc(CO)cc1.NC=O |
| InChI | InChI=1S/C21H34N4O5.C8H11NO.CH3NO/c1-15(2)20(21(30)23-16(14-26)8-7-12-22-3)24-17(27)9-5-4-6-13-25-18(28)10-11-19(25)29;1-9-8-4-2-7(6-10)3-5-8;2-1-3/h10-11,14-16,20,22H,4-9,12-13H2,1-3H3,(H,23,30)(H,24,27);2-5,9-10H,6H2,1H3;1H,(H2,2,3) |
| InChIKey | SXMMMVUFPGIPTK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 200.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.75 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|