C39H42O16 — CID 145051547
1-O-(4-formyloxy-3-methoxycarbonylphenyl) 4-O-[3-methoxycarbonyl-4-[4-(1-prop-2-enoyloxypropan-2-yloxycarbonyl)cyclohexanecarbonyl]oxyphenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 145051547) has the molecular formula C39H42O16 and a molecular weight of 766.75 g/mol. Its IUPAC name is 1-O-(4-formyloxy-3-methoxycarbonylphenyl) 4-O-[3-methoxycarbonyl-4-[4-(1-prop-2-enoyloxypropan-2-yloxycarbonyl)cyclohexanecarbonyl]oxyphenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | 1-O-(4-formyloxy-3-methoxycarbonylphenyl) 4-O-[3-methoxycarbonyl-4-[4-(1-prop-2-enoyloxypropan-2-yloxycarbonyl)cyclohexanecarbonyl]oxyphenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 145051547 |
| Molecular Formula | C39H42O16 |
| Molecular Weight | 766.75 g/mol |
| Exact Mass | 766.25 |
| IUPAC Name | 1-O-(4-formyloxy-3-methoxycarbonylphenyl) 4-O-[3-methoxycarbonyl-4-[4-(1-prop-2-enoyloxypropan-2-yloxycarbonyl)cyclohexanecarbonyl]oxyphenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCC(C)OC(=O)C1CCC(C(=O)Oc2ccc(OC(=O)C3CCC(C(=O)Oc4ccc(OC=O)c(C(=O)OC)c4)CC3)cc2C(=O)OC)CC1 |
| InChI | InChI=1S/C39H42O16/c1-5-33(41)50-20-22(2)52-34(42)23-6-12-26(13-7-23)37(45)55-32-17-15-28(19-30(32)39(47)49-4)54-36(44)25-10-8-24(9-11-25)35(43)53-27-14-16-31(51-21-40)29(18-27)38(46)48-3/h5,14-19,21-26H,1,6-13,20H2,2-4H3 |
| InChIKey | SSBDHYJSWIMXGO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 210.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.75 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|