C12H15NO — CID 145055558
8-amino-5,6-dimethyl-5,6-dihydronaphthalen-1-ol (PubChem CID 145055558) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 8-amino-5,6-dimethyl-5,6-dihydronaphthalen-1-ol.
| Compound Name | 8-amino-5,6-dimethyl-5,6-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 145055558 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 8-amino-5,6-dimethyl-5,6-dihydronaphthalen-1-ol |
| SMILES | CC1C=C(N)c2c(O)cccc2C1C |
| InChI | InChI=1S/C12H15NO/c1-7-6-10(13)12-9(8(7)2)4-3-5-11(12)14/h3-8,14H,13H2,1-2H3 |
| InChIKey | MDSJRENNEDOTBF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |