C30H40BF3N4O4 — CID 145056836
methyl 1-[cyanatoboranylidene-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-N-[(Z)-1-[4-(2-cyclopentylethyl)-3-(trifluoromethyl)phenyl]prop-1-enyl]pyrrolidine-2-carboximidate (PubChem CID 145056836) has the molecular formula C30H40BF3N4O4 and a molecular weight of 588.48 g/mol. Its IUPAC name is methyl 1-[cyanatoboranylidene-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-N-[(Z)-1-[4-(2-cyclopentylethyl)-3-(trifluoromethyl)phenyl]prop-1-enyl]pyrrolidine-2-carboximidate.
| Compound Name | methyl 1-[cyanatoboranylidene-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-N-[(Z)-1-[4-(2-cyclopentylethyl)-3-(trifluoromethyl)phenyl]prop-1-enyl]pyrrolidine-2-carboximidate |
|---|---|
| PubChem CID | 145056836 |
| Molecular Formula | C30H40BF3N4O4 |
| Molecular Weight | 588.48 g/mol |
| Exact Mass | 588.31 |
| IUPAC Name | methyl 1-[cyanatoboranylidene-[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-N-[(Z)-1-[4-(2-cyclopentylethyl)-3-(trifluoromethyl)phenyl]prop-1-enyl]pyrrolidine-2-carboximidate |
| SMILES | C/C=C(\N=C(/OC)C1CCCN1/C(=B/OC#N)NC(=O)OC(C)(C)C)c1ccc(CCC2CCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H40BF3N4O4/c1-6-24(22-16-15-21(23(18-22)30(32,33)34)14-13-20-10-7-8-11-20)36-26(40-5)25-12-9-17-38(25)27(31-41-19-35)37-28(39)42-29(2,3)4/h6,15-16,18,20,25H,7-14,17H2,1-5H3,(H,37,39)/b24-6-,36-26- |
| InChIKey | QBDRDQLZQBOSHX-GVZWFOHTSA-N |
| XLogP | 6.43 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.48 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|