C37H56BF3N4O3 — CID 145056680
tert-butyl N-[[2-[C-butan-2-yl-N-[(Z)-1-[4-(2-cyclohexylethyl)-3-(trifluoromethyl)phenyl]but-1-enyl]carbonimidoyl]pyrrolidin-1-yl]-cyanatoboranylidenemethyl]carbamate;ethane (PubChem CID 145056680) has the molecular formula C37H56BF3N4O3 and a molecular weight of 672.69 g/mol. Its IUPAC name is tert-butyl N-[[2-[C-butan-2-yl-N-[(Z)-1-[4-(2-cyclohexylethyl)-3-(trifluoromethyl)phenyl]but-1-enyl]carbonimidoyl]pyrrolidin-1-yl]-cyanatoboranylidenemethyl]carbamate;ethane.
| Compound Name | tert-butyl N-[[2-[C-butan-2-yl-N-[(Z)-1-[4-(2-cyclohexylethyl)-3-(trifluoromethyl)phenyl]but-1-enyl]carbonimidoyl]pyrrolidin-1-yl]-cyanatoboranylidenemethyl]carbamate;ethane |
|---|---|
| PubChem CID | 145056680 |
| Molecular Formula | C37H56BF3N4O3 |
| Molecular Weight | 672.69 g/mol |
| Exact Mass | 672.44 |
| IUPAC Name | tert-butyl N-[[2-[C-butan-2-yl-N-[(Z)-1-[4-(2-cyclohexylethyl)-3-(trifluoromethyl)phenyl]but-1-enyl]carbonimidoyl]pyrrolidin-1-yl]-cyanatoboranylidenemethyl]carbamate;ethane |
| SMILES | CC.CC/C=C(\N=C(\C(C)CC)C1CCCN1/C(=B/OC#N)NC(=O)OC(C)(C)C)c1ccc(CCC2CCCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C35H50BF3N4O3.C2H6/c1-7-13-29(27-20-19-26(28(22-27)35(37,38)39)18-17-25-14-10-9-11-15-25)41-31(24(3)8-2)30-16-12-21-43(30)32(36-45-23-40)42-33(44)46-34(4,5)6;1-2/h13,19-20,22,24-25,30H,7-12,14-18,21H2,1-6H3,(H,42,44);1-2H3/b29-13-,41-31-; |
| InChIKey | VVVQSPCTHBFIEM-UTRAEZNYSA-N |
| XLogP | 9.68 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.69 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|