C29H37BF3N5O3 — CID 145056772
tert-butyl N-[cyanatoboranylidene-[2-[6-[4-(2-cyclopentylethyl)-3-(trifluoromethyl)phenyl]-1,4-dihydropyrimidin-2-yl]pyrrolidin-1-yl]methyl]carbamate (PubChem CID 145056772) has the molecular formula C29H37BF3N5O3 and a molecular weight of 571.45 g/mol. Its IUPAC name is tert-butyl N-[cyanatoboranylidene-[2-[6-[4-(2-cyclopentylethyl)-3-(trifluoromethyl)phenyl]-1,4-dihydropyrimidin-2-yl]pyrrolidin-1-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[cyanatoboranylidene-[2-[6-[4-(2-cyclopentylethyl)-3-(trifluoromethyl)phenyl]-1,4-dihydropyrimidin-2-yl]pyrrolidin-1-yl]methyl]carbamate |
|---|---|
| PubChem CID | 145056772 |
| Molecular Formula | C29H37BF3N5O3 |
| Molecular Weight | 571.45 g/mol |
| Exact Mass | 571.29 |
| IUPAC Name | tert-butyl N-[cyanatoboranylidene-[2-[6-[4-(2-cyclopentylethyl)-3-(trifluoromethyl)phenyl]-1,4-dihydropyrimidin-2-yl]pyrrolidin-1-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N/C(=B\OC#N)N1CCCC1C1=NCC=C(c2ccc(CCC3CCCC3)c(C(F)(F)F)c2)N1 |
| InChI | InChI=1S/C29H37BF3N5O3/c1-28(2,3)41-27(39)37-26(30-40-18-34)38-16-6-9-24(38)25-35-15-14-23(36-25)21-13-12-20(22(17-21)29(31,32)33)11-10-19-7-4-5-8-19/h12-14,17,19,24H,4-11,15-16H2,1-3H3,(H,35,36)(H,37,39) |
| InChIKey | FASAWPAXWPTZEY-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|