C34H41BF3N5O3 — CID 145056885
tert-butyl N-[[2-[6-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]-1,4-dihydropyrimidin-2-yl]pyrrolidin-1-yl]-cyanatoboranylidenemethyl]carbamate (PubChem CID 145056885) has the molecular formula C34H41BF3N5O3 and a molecular weight of 635.54 g/mol. Its IUPAC name is tert-butyl N-[[2-[6-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]-1,4-dihydropyrimidin-2-yl]pyrrolidin-1-yl]-cyanatoboranylidenemethyl]carbamate.
| Compound Name | tert-butyl N-[[2-[6-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]-1,4-dihydropyrimidin-2-yl]pyrrolidin-1-yl]-cyanatoboranylidenemethyl]carbamate |
|---|---|
| PubChem CID | 145056885 |
| Molecular Formula | C34H41BF3N5O3 |
| Molecular Weight | 635.54 g/mol |
| Exact Mass | 635.33 |
| IUPAC Name | tert-butyl N-[[2-[6-[4-[2-(4-butylphenyl)ethyl]-3-(trifluoromethyl)phenyl]-1,4-dihydropyrimidin-2-yl]pyrrolidin-1-yl]-cyanatoboranylidenemethyl]carbamate |
| SMILES | CCCCc1ccc(CCc2ccc(C3=CCN=C(C4CCCN4/C(=B/OC#N)NC(=O)OC(C)(C)C)N3)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C34H41BF3N5O3/c1-5-6-8-23-10-12-24(13-11-23)14-15-25-16-17-26(21-27(25)34(36,37)38)28-18-19-40-30(41-28)29-9-7-20-43(29)31(35-45-22-39)42-32(44)46-33(2,3)4/h10-13,16-18,21,29H,5-9,14-15,19-20H2,1-4H3,(H,40,41)(H,42,44) |
| InChIKey | WHZTVZAOGZNCJU-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.54 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|