C11H9FN2O — CID 145057906
2-(5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-oxazole (PubChem CID 145057906) has the molecular formula C11H9FN2O and a molecular weight of 204.20 g/mol. Its IUPAC name is 2-(5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 145057906 |
| Molecular Formula | C11H9FN2O |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 2-(5-fluoro-1H-indol-2-yl)-4,5-dihydro-1,3-oxazole |
| SMILES | Fc1ccc2[nH]c(C3=NCCO3)cc2c1 |
| InChI | InChI=1S/C11H9FN2O/c12-8-1-2-9-7(5-8)6-10(14-9)11-13-3-4-15-11/h1-2,5-6,14H,3-4H2 |
| InChIKey | CZSFXWGKQIYSHI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |