C14H8F3N — CID 131887083
2-(2,4-difluorophenyl)-5-fluoro-1H-indole (PubChem CID 131887083) has the molecular formula C14H8F3N and a molecular weight of 247.22 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-5-fluoro-1H-indole.
| Compound Name | 2-(2,4-difluorophenyl)-5-fluoro-1H-indole |
|---|---|
| PubChem CID | 131887083 |
| Molecular Formula | C14H8F3N |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2-(2,4-difluorophenyl)-5-fluoro-1H-indole |
| SMILES | Fc1ccc(-c2cc3cc(F)ccc3[nH]2)c(F)c1 |
| InChI | InChI=1S/C14H8F3N/c15-9-2-4-13-8(5-9)6-14(18-13)11-3-1-10(16)7-12(11)17/h1-7,18H |
| InChIKey | CPLRIMZAFRDXNQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |