C28H32F3N7O2 — CID 145057998
1-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-4-(trifluoromethoxy)anilino]prop-2-en-1-ol (PubChem CID 145057998) has the molecular formula C28H32F3N7O2 and a molecular weight of 555.61 g/mol. Its IUPAC name is 1-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-4-(trifluoromethoxy)anilino]prop-2-en-1-ol.
| Compound Name | 1-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-4-(trifluoromethoxy)anilino]prop-2-en-1-ol |
|---|---|
| PubChem CID | 145057998 |
| Molecular Formula | C28H32F3N7O2 |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | 1-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-4-(trifluoromethoxy)anilino]prop-2-en-1-ol |
| SMILES | C=CC(O)Nc1cc(Nc2nccc(-c3cn(C)c4ccccc34)n2)c(OC(F)(F)F)cc1N(C)CCN(C)C |
| InChI | InChI=1S/C28H32F3N7O2/c1-6-26(39)33-21-15-22(25(40-28(29,30)31)16-24(21)37(4)14-13-36(2)3)35-27-32-12-11-20(34-27)19-17-38(5)23-10-8-7-9-18(19)23/h6-12,15-17,26,33,39H,1,13-14H2,2-5H3,(H,32,34,35) |
| InChIKey | AYDHCYHREWSLBC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|