C31H36F3N7O5S — CID 175570968
(2Z)-N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-4-(trifluoromethoxy)phenyl]penta-2,4-dienamide;methanesulfonic acid (PubChem CID 175570968) has the molecular formula C31H36F3N7O5S and a molecular weight of 675.73 g/mol. Its IUPAC name is (2Z)-N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-4-(trifluoromethoxy)phenyl]penta-2,4-dienamide;methanesulfonic acid.
| Compound Name | (2Z)-N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-4-(trifluoromethoxy)phenyl]penta-2,4-dienamide;methanesulfonic acid |
|---|---|
| PubChem CID | 175570968 |
| Molecular Formula | C31H36F3N7O5S |
| Molecular Weight | 675.73 g/mol |
| Exact Mass | 675.25 |
| IUPAC Name | (2Z)-N-[2-[2-(dimethylamino)ethyl-methylamino]-5-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-4-(trifluoromethoxy)phenyl]penta-2,4-dienamide;methanesulfonic acid |
| SMILES | C=C/C=C\C(=O)Nc1cc(Nc2nccc(-c3cn(C)c4ccccc34)n2)c(OC(F)(F)F)cc1N(C)CCN(C)C.CS(=O)(=O)O |
| InChI | InChI=1S/C30H32F3N7O2.CH4O3S/c1-6-7-12-28(41)35-23-17-24(27(42-30(31,32)33)18-26(23)39(4)16-15-38(2)3)37-29-34-14-13-22(36-29)21-19-40(5)25-11-9-8-10-20(21)25;1-5(2,3)4/h6-14,17-19H,1,15-16H2,2-5H3,(H,35,41)(H,34,36,37);1H3,(H,2,3,4)/b12-7-; |
| InChIKey | JTQHZAAAMWSJJT-OZLKFZLXSA-N |
| XLogP | 5.46 |
| TPSA | 141.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.73 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|