C17H21N5S — CID 145061746
N-benzyl-6-(diethylaminosulfanyl)-[1,2,4]triazolo[4,3-a]pyridin-3-amine (PubChem CID 145061746) has the molecular formula C17H21N5S and a molecular weight of 327.46 g/mol. Its IUPAC name is N-benzyl-6-(diethylaminosulfanyl)-[1,2,4]triazolo[4,3-a]pyridin-3-amine.
| Compound Name | N-benzyl-6-(diethylaminosulfanyl)-[1,2,4]triazolo[4,3-a]pyridin-3-amine |
|---|---|
| PubChem CID | 145061746 |
| Molecular Formula | C17H21N5S |
| Molecular Weight | 327.46 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N-benzyl-6-(diethylaminosulfanyl)-[1,2,4]triazolo[4,3-a]pyridin-3-amine |
| SMILES | CCN(CC)Sc1ccc2nnc(NCc3ccccc3)n2c1 |
| InChI | InChI=1S/C17H21N5S/c1-3-21(4-2)23-15-10-11-16-19-20-17(22(16)13-15)18-12-14-8-6-5-7-9-14/h5-11,13H,3-4,12H2,1-2H3,(H,18,20) |
| InChIKey | ZTJZFSLETRPCPQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|