C13H13N5 — CID 121260958
3-N-benzyl-[1,2,4]triazolo[4,3-a]pyridine-3,6-diamine (PubChem CID 121260958) has the molecular formula C13H13N5 and a molecular weight of 239.28 g/mol. Its IUPAC name is 3-N-benzyl-[1,2,4]triazolo[4,3-a]pyridine-3,6-diamine.
| Compound Name | 3-N-benzyl-[1,2,4]triazolo[4,3-a]pyridine-3,6-diamine |
|---|---|
| PubChem CID | 121260958 |
| Molecular Formula | C13H13N5 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 3-N-benzyl-[1,2,4]triazolo[4,3-a]pyridine-3,6-diamine |
| SMILES | Nc1ccc2nnc(NCc3ccccc3)n2c1 |
| InChI | InChI=1S/C13H13N5/c14-11-6-7-12-16-17-13(18(12)9-11)15-8-10-4-2-1-3-5-10/h1-7,9H,8,14H2,(H,15,17) |
| InChIKey | DPFVIIFEOGPOFB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |