C26H32ClFN6 — CID 145063522
5-chloro-4-(1H-indol-3-yl)pyrimidin-2-amine;cyclohexane;4-[[fluoro(methyl)amino]methyl]aniline (PubChem CID 145063522) has the molecular formula C26H32ClFN6 and a molecular weight of 483.04 g/mol. Its IUPAC name is 5-chloro-4-(1H-indol-3-yl)pyrimidin-2-amine;cyclohexane;4-[[fluoro(methyl)amino]methyl]aniline.
| Compound Name | 5-chloro-4-(1H-indol-3-yl)pyrimidin-2-amine;cyclohexane;4-[[fluoro(methyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 145063522 |
| Molecular Formula | C26H32ClFN6 |
| Molecular Weight | 483.04 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 5-chloro-4-(1H-indol-3-yl)pyrimidin-2-amine;cyclohexane;4-[[fluoro(methyl)amino]methyl]aniline |
| SMILES | C1CCCCC1.CN(F)Cc1ccc(N)cc1.Nc1ncc(Cl)c(-c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C12H9ClN4.C8H11FN2.C6H12/c13-9-6-16-12(14)17-11(9)8-5-15-10-4-2-1-3-7(8)10;1-11(9)6-7-2-4-8(10)5-3-7;1-2-4-6-5-3-1/h1-6,15H,(H2,14,16,17);2-5H,6,10H2,1H3;1-6H2 |
| InChIKey | VVQDFGMUVHMXOA-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.04 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|