C29H37N3O3S — CID 145064467
tert-butyl 5-ethyl-3-methyl-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-1,2-benzothiazole-2-carboxylate;2-(6-ethenyl-3-pyridinyl)benzonitrile (PubChem CID 145064467) has the molecular formula C29H37N3O3S and a molecular weight of 507.70 g/mol. Its IUPAC name is tert-butyl 5-ethyl-3-methyl-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-1,2-benzothiazole-2-carboxylate;2-(6-ethenyl-3-pyridinyl)benzonitrile.
| Compound Name | tert-butyl 5-ethyl-3-methyl-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-1,2-benzothiazole-2-carboxylate;2-(6-ethenyl-3-pyridinyl)benzonitrile |
|---|---|
| PubChem CID | 145064467 |
| Molecular Formula | C29H37N3O3S |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | tert-butyl 5-ethyl-3-methyl-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-1,2-benzothiazole-2-carboxylate;2-(6-ethenyl-3-pyridinyl)benzonitrile |
| SMILES | C=Cc1ccc(-c2ccccc2C#N)cn1.CCC1CCC2C(C1)C(C)N(C(=O)OC(C)(C)C)S2=O |
| InChI | InChI=1S/C15H27NO3S.C14H10N2/c1-6-11-7-8-13-12(9-11)10(2)16(20(13)18)14(17)19-15(3,4)5;1-2-13-8-7-12(10-16-13)14-6-4-3-5-11(14)9-15/h10-13H,6-9H2,1-5H3;2-8,10H,1H2 |
| InChIKey | DQCSVZRUYUUGHR-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |