C25H27F2N3O2S — CID 145064486
1-[(5R)-6,6-difluoro-3,5-dimethyl-1-oxo-3,3a,4,5,7,7a-hexahydro-1,2-benzothiazol-2-yl]ethanone;2-(6-ethenyl-3-pyridinyl)benzonitrile (PubChem CID 145064486) has the molecular formula C25H27F2N3O2S and a molecular weight of 471.57 g/mol. Its IUPAC name is 1-[(5R)-6,6-difluoro-3,5-dimethyl-1-oxo-3,3a,4,5,7,7a-hexahydro-1,2-benzothiazol-2-yl]ethanone;2-(6-ethenyl-3-pyridinyl)benzonitrile.
| Compound Name | 1-[(5R)-6,6-difluoro-3,5-dimethyl-1-oxo-3,3a,4,5,7,7a-hexahydro-1,2-benzothiazol-2-yl]ethanone;2-(6-ethenyl-3-pyridinyl)benzonitrile |
|---|---|
| PubChem CID | 145064486 |
| Molecular Formula | C25H27F2N3O2S |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 1-[(5R)-6,6-difluoro-3,5-dimethyl-1-oxo-3,3a,4,5,7,7a-hexahydro-1,2-benzothiazol-2-yl]ethanone;2-(6-ethenyl-3-pyridinyl)benzonitrile |
| SMILES | C=Cc1ccc(-c2ccccc2C#N)cn1.CC(=O)N1C(C)C2C[C@@H](C)C(F)(F)CC2S1=O |
| InChI | InChI=1S/C14H10N2.C11H17F2NO2S/c1-2-13-8-7-12(10-16-13)14-6-4-3-5-11(14)9-15;1-6-4-9-7(2)14(8(3)15)17(16)10(9)5-11(6,12)13/h2-8,10H,1H2;6-7,9-10H,4-5H2,1-3H3/t;6-,7?,9?,10?,17?/m.1/s1 |
| InChIKey | XFCWSLZZCMMJKF-VHBWHMEWSA-N |
| XLogP | 5.21 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |