C22H24F2N4S — CID 145064483
6,6-difluoro-3,5-dimethyl-3,3a,4,5,7,7a-hexahydro-2H-1,2-benzothiazole;3-(6-ethenyl-3-pyridinyl)pyridine-2-carbonitrile (PubChem CID 145064483) has the molecular formula C22H24F2N4S and a molecular weight of 414.53 g/mol. Its IUPAC name is 6,6-difluoro-3,5-dimethyl-3,3a,4,5,7,7a-hexahydro-2H-1,2-benzothiazole;3-(6-ethenyl-3-pyridinyl)pyridine-2-carbonitrile.
| Compound Name | 6,6-difluoro-3,5-dimethyl-3,3a,4,5,7,7a-hexahydro-2H-1,2-benzothiazole;3-(6-ethenyl-3-pyridinyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 145064483 |
| Molecular Formula | C22H24F2N4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 6,6-difluoro-3,5-dimethyl-3,3a,4,5,7,7a-hexahydro-2H-1,2-benzothiazole;3-(6-ethenyl-3-pyridinyl)pyridine-2-carbonitrile |
| SMILES | C=Cc1ccc(-c2cccnc2C#N)cn1.CC1NSC2CC(F)(F)C(C)CC12 |
| InChI | InChI=1S/C13H9N3.C9H15F2NS/c1-2-11-6-5-10(9-16-11)12-4-3-7-15-13(12)8-14;1-5-3-7-6(2)12-13-8(7)4-9(5,10)11/h2-7,9H,1H2;5-8,12H,3-4H2,1-2H3 |
| InChIKey | NDZSQGSENNZKHI-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|