C24H25N3O2S — CID 143603888
2-[2-amino-4-[(E)-2-[5-(2-cyanophenyl)-2-pyridinyl]ethenyl]-2,3-dimethyl-6-oxocyclohexyl]ethanethioic S-acid (PubChem CID 143603888) has the molecular formula C24H25N3O2S and a molecular weight of 419.55 g/mol. Its IUPAC name is 2-[2-amino-4-[(E)-2-[5-(2-cyanophenyl)-2-pyridinyl]ethenyl]-2,3-dimethyl-6-oxocyclohexyl]ethanethioic S-acid.
| Compound Name | 2-[2-amino-4-[(E)-2-[5-(2-cyanophenyl)-2-pyridinyl]ethenyl]-2,3-dimethyl-6-oxocyclohexyl]ethanethioic S-acid |
|---|---|
| PubChem CID | 143603888 |
| Molecular Formula | C24H25N3O2S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 2-[2-amino-4-[(E)-2-[5-(2-cyanophenyl)-2-pyridinyl]ethenyl]-2,3-dimethyl-6-oxocyclohexyl]ethanethioic S-acid |
| SMILES | CC1C(/C=C/c2ccc(-c3ccccc3C#N)cn2)CC(=O)C(CC(=O)S)C1(C)N |
| InChI | InChI=1S/C24H25N3O2S/c1-15-16(11-22(28)21(12-23(29)30)24(15,2)26)7-9-19-10-8-18(14-27-19)20-6-4-3-5-17(20)13-25/h3-10,14-16,21H,11-12,26H2,1-2H3,(H,29,30)/b9-7+ |
| InChIKey | YVLCEDZGJLWADE-VQHVLOKHSA-N |
| XLogP | 4.04 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|