C24H23N3S — CID 163482130
2-[6-[(E)-2-[(4S,5R,6S)-4,5,6-trimethyl-6,7-dihydro-5H-2,1-benzothiazol-4-yl]ethenyl]-3-pyridinyl]benzonitrile (PubChem CID 163482130) has the molecular formula C24H23N3S and a molecular weight of 385.54 g/mol. Its IUPAC name is 2-[6-[(E)-2-[(4S,5R,6S)-4,5,6-trimethyl-6,7-dihydro-5H-2,1-benzothiazol-4-yl]ethenyl]-3-pyridinyl]benzonitrile.
| Compound Name | 2-[6-[(E)-2-[(4S,5R,6S)-4,5,6-trimethyl-6,7-dihydro-5H-2,1-benzothiazol-4-yl]ethenyl]-3-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 163482130 |
| Molecular Formula | C24H23N3S |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 2-[6-[(E)-2-[(4S,5R,6S)-4,5,6-trimethyl-6,7-dihydro-5H-2,1-benzothiazol-4-yl]ethenyl]-3-pyridinyl]benzonitrile |
| SMILES | C[C@@H]1[C@@H](C)Cc2nscc2[C@@]1(C)/C=C/c1ccc(-c2ccccc2C#N)cn1 |
| InChI | InChI=1S/C24H23N3S/c1-16-12-23-22(15-28-27-23)24(3,17(16)2)11-10-20-9-8-19(14-26-20)21-7-5-4-6-18(21)13-25/h4-11,14-17H,12H2,1-3H3/b11-10+/t16-,17+,24-/m0/s1 |
| InChIKey | CFLRQPRGOQOYKM-KMJJJXSNSA-N |
| XLogP | 5.88 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |