C8H16N4 — CID 145064548
3-[(Z)-but-1-enyl]-1,2,4-triazol-4-amine;ethane (PubChem CID 145064548) has the molecular formula C8H16N4 and a molecular weight of 168.24 g/mol. Its IUPAC name is 3-[(Z)-but-1-enyl]-1,2,4-triazol-4-amine;ethane.
| Compound Name | 3-[(Z)-but-1-enyl]-1,2,4-triazol-4-amine;ethane |
|---|---|
| PubChem CID | 145064548 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 3-[(Z)-but-1-enyl]-1,2,4-triazol-4-amine;ethane |
| SMILES | CC.CC/C=C\c1nncn1N |
| InChI | InChI=1S/C6H10N4.C2H6/c1-2-3-4-6-9-8-5-10(6)7;1-2/h3-5H,2,7H2,1H3;1-2H3/b4-3-; |
| InChIKey | VWQYORGJCOCILK-LNKPDPKZSA-N |
| XLogP | 1.44 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |