About 5,6-dihydro-[1,2,4]triazolo[4,3-a]pyridine;ethane
5,6-dihydro-[1,2,4]triazolo[4,3-a]pyridine;ethane (PubChem CID 142875419) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 5,6-dihydro-[1,2,4]triazolo[4,3-a]pyridine;ethane.
Analyze 5,6-dihydro-[1,2,4]triazolo[4,3-a]pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-[1,2,4]triazolo[4,3-a]pyridine;ethane?
The IUPAC name of 5,6-dihydro-[1,2,4]triazolo[4,3-a]pyridine;ethane (CID 142875419) is 5,6-dihydro-[1,2,4]triazolo[4,3-a]pyridine;ethane.
What is the SMILES notation for 5,6-dihydro-[1,2,4]triazolo[4,3-a]pyridine;ethane?
The canonical SMILES for 5,6-dihydro-[1,2,4]triazolo[4,3-a]pyridine;ethane is C1=Cc2nncn2CC1.CC.
What is the InChIKey of 5,6-dihydro-[1,2,4]triazolo[4,3-a]pyridine;ethane?
The InChIKey is FJDONPIJYVNHRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3.C2H6/c1-2-4-9-5-7-8-6(9)3-1;1-2/h1,3,5H,2,4H2;1-2H3.
What are the key properties of 5,6-dihydro-[1,2,4]triazolo[4,3-a]pyridine;ethane?
5,6-dihydro-[1,2,4]triazolo[4,3-a]pyridine;ethane has a molecular weight of 151.21 g/mol, XLogP of 1.72, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-[1,2,4]triazolo[4,3-a]pyridine;ethane is sourced from PubChem (CID 142875419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).