About ethane;1-fluoro-3-(4-methylpentyl)cyclohexene;propane
ethane;1-fluoro-3-(4-methylpentyl)cyclohexene;propane (PubChem CID 145066156) has the molecular formula C17H35F
and a molecular weight of 258.46 g/mol. Its IUPAC name is ethane;1-fluoro-3-(4-methylpentyl)cyclohexene;propane.
Molecular Properties
| Compound Name | ethane;1-fluoro-3-(4-methylpentyl)cyclohexene;propane |
| PubChem CID | 145066156 |
| Molecular Formula | C17H35F |
| Molecular Weight | 258.46 g/mol |
| Exact Mass | 258.27 |
| IUPAC Name | ethane;1-fluoro-3-(4-methylpentyl)cyclohexene;propane |
| SMILES | CC.CC(C)CCCC1C=C(F)CCC1.CCC |
| InChI | InChI=1S/C12H21F.C3H8.C2H6/c1-10(2)5-3-6-11-7-4-8-12(13)9-11;1-3-2;1-2/h9-11H,3-8H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | DIGVKWRFWJOMSP-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.46 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;1-fluoro-3-(4-methylpentyl)cyclohexene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-fluoro-3-(4-methylpentyl)cyclohexene;propane?
The IUPAC name of ethane;1-fluoro-3-(4-methylpentyl)cyclohexene;propane (CID 145066156) is ethane;1-fluoro-3-(4-methylpentyl)cyclohexene;propane.
What is the SMILES notation for ethane;1-fluoro-3-(4-methylpentyl)cyclohexene;propane?
The canonical SMILES for ethane;1-fluoro-3-(4-methylpentyl)cyclohexene;propane is CC.CC(C)CCCC1C=C(F)CCC1.CCC.
What is the InChIKey of ethane;1-fluoro-3-(4-methylpentyl)cyclohexene;propane?
The InChIKey is DIGVKWRFWJOMSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F.C3H8.C2H6/c1-10(2)5-3-6-11-7-4-8-12(13)9-11;1-3-2;1-2/h9-11H,3-8H2,1-2H3;3H2,1-2H3;1-2H3.
What are the key properties of ethane;1-fluoro-3-(4-methylpentyl)cyclohexene;propane?
ethane;1-fluoro-3-(4-methylpentyl)cyclohexene;propane has a molecular weight of 258.46 g/mol, XLogP of 6.91, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-fluoro-3-(4-methylpentyl)cyclohexene;propane is sourced from PubChem (CID 145066156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).