C13H19F3 — CID 145069435
1,6-dimethyl-2-(trifluoromethyl)-1,2,3,4,4a,5,8,8a-octahydronaphthalene (PubChem CID 145069435) has the molecular formula C13H19F3 and a molecular weight of 232.29 g/mol. Its IUPAC name is 1,6-dimethyl-2-(trifluoromethyl)-1,2,3,4,4a,5,8,8a-octahydronaphthalene.
| Compound Name | 1,6-dimethyl-2-(trifluoromethyl)-1,2,3,4,4a,5,8,8a-octahydronaphthalene |
|---|---|
| PubChem CID | 145069435 |
| Molecular Formula | C13H19F3 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 1,6-dimethyl-2-(trifluoromethyl)-1,2,3,4,4a,5,8,8a-octahydronaphthalene |
| SMILES | CC1=CCC2C(CCC(C(F)(F)F)C2C)C1 |
| InChI | InChI=1S/C13H19F3/c1-8-3-5-11-9(2)12(13(14,15)16)6-4-10(11)7-8/h3,9-12H,4-7H2,1-2H3 |
| InChIKey | WVRHTSNAOTZYSL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|