C19H23NO6 — CID 145069557
2-[[1-(2-ethyl-4,5-dihydroxyphenyl)-2-(4-hydroxy-3-methoxyphenyl)ethyl]amino]acetic acid (PubChem CID 145069557) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is 2-[[1-(2-ethyl-4,5-dihydroxyphenyl)-2-(4-hydroxy-3-methoxyphenyl)ethyl]amino]acetic acid.
| Compound Name | 2-[[1-(2-ethyl-4,5-dihydroxyphenyl)-2-(4-hydroxy-3-methoxyphenyl)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 145069557 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 2-[[1-(2-ethyl-4,5-dihydroxyphenyl)-2-(4-hydroxy-3-methoxyphenyl)ethyl]amino]acetic acid |
| SMILES | CCc1cc(O)c(O)cc1C(Cc1ccc(O)c(OC)c1)NCC(=O)O |
| InChI | InChI=1S/C19H23NO6/c1-3-12-8-16(22)17(23)9-13(12)14(20-10-19(24)25)6-11-4-5-15(21)18(7-11)26-2/h4-5,7-9,14,20-23H,3,6,10H2,1-2H3,(H,24,25) |
| InChIKey | ZEZJOMQPLMESQC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|