C16H17N3 — CID 145072736
6-methyl-5-propyl-1,10-phenanthrolin-2-amine (PubChem CID 145072736) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 6-methyl-5-propyl-1,10-phenanthrolin-2-amine.
| Compound Name | 6-methyl-5-propyl-1,10-phenanthrolin-2-amine |
|---|---|
| PubChem CID | 145072736 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 6-methyl-5-propyl-1,10-phenanthrolin-2-amine |
| SMILES | CCCc1c(C)c2cccnc2c2nc(N)ccc12 |
| InChI | InChI=1S/C16H17N3/c1-3-5-11-10(2)12-6-4-9-18-15(12)16-13(11)7-8-14(17)19-16/h4,6-9H,3,5H2,1-2H3,(H2,17,19) |
| InChIKey | WTPOXZHPVFXBOM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|