C23H25FN2O2 — CID 145078393
N-(4-fluorophenyl)-2-(1-hydroxycyclohexyl)acetamide;quinoline (PubChem CID 145078393) has the molecular formula C23H25FN2O2 and a molecular weight of 380.46 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-(1-hydroxycyclohexyl)acetamide;quinoline.
| Compound Name | N-(4-fluorophenyl)-2-(1-hydroxycyclohexyl)acetamide;quinoline |
|---|---|
| PubChem CID | 145078393 |
| Molecular Formula | C23H25FN2O2 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | N-(4-fluorophenyl)-2-(1-hydroxycyclohexyl)acetamide;quinoline |
| SMILES | O=C(CC1(O)CCCCC1)Nc1ccc(F)cc1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C14H18FNO2.C9H7N/c15-11-4-6-12(7-5-11)16-13(17)10-14(18)8-2-1-3-9-14;1-2-6-9-8(4-1)5-3-7-10-9/h4-7,18H,1-3,8-10H2,(H,16,17);1-7H |
| InChIKey | NDYBGTPRESGZEP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |