C24H27FN2S — CID 145078456
1-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-N-(3-methylphenyl)sulfanylethanamine (PubChem CID 145078456) has the molecular formula C24H27FN2S and a molecular weight of 394.56 g/mol. Its IUPAC name is 1-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-N-(3-methylphenyl)sulfanylethanamine.
| Compound Name | 1-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-N-(3-methylphenyl)sulfanylethanamine |
|---|---|
| PubChem CID | 145078456 |
| Molecular Formula | C24H27FN2S |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1-[4-(6-fluoroquinolin-4-yl)cyclohexyl]-N-(3-methylphenyl)sulfanylethanamine |
| SMILES | Cc1cccc(SNC(C)C2CCC(c3ccnc4ccc(F)cc34)CC2)c1 |
| InChI | InChI=1S/C24H27FN2S/c1-16-4-3-5-21(14-16)28-27-17(2)18-6-8-19(9-7-18)22-12-13-26-24-11-10-20(25)15-23(22)24/h3-5,10-15,17-19,27H,6-9H2,1-2H3 |
| InChIKey | PLLKHWZDDCKHNS-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|